C8H14N4O — CID 150062756
N-butan-2-yl-4-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 150062756) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is N-butan-2-yl-4-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-butan-2-yl-4-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 150062756 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-butan-2-yl-4-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1nncn1C |
| InChI | InChI=1S/C8H14N4O/c1-4-6(2)10-8(13)7-11-9-5-12(7)3/h5-6H,4H2,1-3H3,(H,10,13) |
| InChIKey | DNQGFYCOMQIUPC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |