About 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one
2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one (PubChem CID 130892431) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one |
| PubChem CID | 130892431 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one |
| SMILES | CCC(O)C(=O)c1nncn1C |
| InChI | InChI=1S/C7H11N3O2/c1-3-5(11)6(12)7-9-8-4-10(7)2/h4-5,11H,3H2,1-2H3 |
| InChIKey | RWSMDXDEKRUBES-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one?
The IUPAC name of 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one (CID 130892431) is 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one.
What is the SMILES notation for 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one?
The canonical SMILES for 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one is CCC(O)C(=O)c1nncn1C.
What is the InChIKey of 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one?
The InChIKey is RWSMDXDEKRUBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-3-5(11)6(12)7-9-8-4-10(7)2/h4-5,11H,3H2,1-2H3.
What are the key properties of 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one?
2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one has a molecular weight of 169.18 g/mol, XLogP of -0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one is sourced from PubChem (CID 130892431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).