C7H11N3O2 — CID 130892431
2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one (PubChem CID 130892431) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one.
| Compound Name | 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 130892431 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-hydroxy-1-(4-methyl-1,2,4-triazol-3-yl)butan-1-one |
| SMILES | CCC(O)C(=O)c1nncn1C |
| InChI | InChI=1S/C7H11N3O2/c1-3-5(11)6(12)7-9-8-4-10(7)2/h4-5,11H,3H2,1-2H3 |
| InChIKey | RWSMDXDEKRUBES-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |