About ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate
ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate (PubChem CID 64669570) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate.
Analyze ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate?
The IUPAC name of ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate (CID 64669570) is ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate.
What is the SMILES notation for ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate?
The canonical SMILES for ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate is CCOC(=O)C(CC)NCc1nncn1C.
What is the InChIKey of ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate?
The InChIKey is FHEFDOTWHOIPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2/c1-4-8(10(15)16-5-2)11-6-9-13-12-7-14(9)3/h7-8,11H,4-6H2,1-3H3.
What are the key properties of ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate?
ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate has a molecular weight of 226.28 g/mol, XLogP of 0.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butanoate is sourced from PubChem (CID 64669570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).