C10H16ClN5OS — CID 22301184
1-butyl-1-[(4-chloro-1-methylpyrazole-3-carbonyl)amino]thiourea (PubChem CID 22301184) has the molecular formula C10H16ClN5OS and a molecular weight of 289.79 g/mol. Its IUPAC name is 1-butyl-1-[(4-chloro-1-methylpyrazole-3-carbonyl)amino]thiourea.
| Compound Name | 1-butyl-1-[(4-chloro-1-methylpyrazole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 22301184 |
| Molecular Formula | C10H16ClN5OS |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-butyl-1-[(4-chloro-1-methylpyrazole-3-carbonyl)amino]thiourea |
| SMILES | CCCCN(NC(=O)c1nn(C)cc1Cl)C(N)=S |
| InChI | InChI=1S/C10H16ClN5OS/c1-3-4-5-16(10(12)18)14-9(17)8-7(11)6-15(2)13-8/h6H,3-5H2,1-2H3,(H2,12,18)(H,14,17) |
| InChIKey | SRLFQJQJGXUVPG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|