C11H18BrN5OS — CID 22305897
1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-1-butylthiourea (PubChem CID 22305897) has the molecular formula C11H18BrN5OS and a molecular weight of 348.27 g/mol. Its IUPAC name is 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-1-butylthiourea.
| Compound Name | 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-1-butylthiourea |
|---|---|
| PubChem CID | 22305897 |
| Molecular Formula | C11H18BrN5OS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-1-butylthiourea |
| SMILES | CCCCN(NC(=O)c1nn(C)c(C)c1Br)C(N)=S |
| InChI | InChI=1S/C11H18BrN5OS/c1-4-5-6-17(11(13)19)15-10(18)9-8(12)7(2)16(3)14-9/h4-6H2,1-3H3,(H2,13,19)(H,15,18) |
| InChIKey | HBGDXFXPUDMSPC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|