C8H12BrN3OS — CID 19266193
4-bromo-1,5-dimethyl-N-(2-sulfanylethyl)pyrazole-3-carboxamide (PubChem CID 19266193) has the molecular formula C8H12BrN3OS and a molecular weight of 278.18 g/mol. Its IUPAC name is 4-bromo-1,5-dimethyl-N-(2-sulfanylethyl)pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1,5-dimethyl-N-(2-sulfanylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266193 |
| Molecular Formula | C8H12BrN3OS |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 4-bromo-1,5-dimethyl-N-(2-sulfanylethyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(Br)c(C(=O)NCCS)nn1C |
| InChI | InChI=1S/C8H12BrN3OS/c1-5-6(9)7(11-12(5)2)8(13)10-3-4-14/h14H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | IPODSCKXAXPJPA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|