C9H12N4OS — CID 22301171
1-ethyl-1-(pyridine-2-carbonylamino)thiourea (PubChem CID 22301171) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-ethyl-1-(pyridine-2-carbonylamino)thiourea.
| Compound Name | 1-ethyl-1-(pyridine-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 22301171 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-ethyl-1-(pyridine-2-carbonylamino)thiourea |
| SMILES | CCN(NC(=O)c1ccccn1)C(N)=S |
| InChI | InChI=1S/C9H12N4OS/c1-2-13(9(10)15)12-8(14)7-5-3-4-6-11-7/h3-6H,2H2,1H3,(H2,10,15)(H,12,14) |
| InChIKey | QOJSNWNZEPCCIP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|