C15H15N5O2S2 — CID 77081831
N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 77081831) has the molecular formula C15H15N5O2S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 77081831 |
| Molecular Formula | C15H15N5O2S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nnc(SCCNC(=O)c2cc(=O)n(-c3ccccc3)[nH]2)s1 |
| InChI | InChI=1S/C15H15N5O2S2/c1-10-17-18-15(24-10)23-8-7-16-14(22)12-9-13(21)20(19-12)11-5-3-2-4-6-11/h2-6,9,19H,7-8H2,1H3,(H,16,22) |
| InChIKey | QHZHKGBNWLREGB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|