C16H17N5O2S2 — CID 77085866
N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide (PubChem CID 77085866) has the molecular formula C16H17N5O2S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide.
| Compound Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide |
|---|---|
| PubChem CID | 77085866 |
| Molecular Formula | C16H17N5O2S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide |
| SMILES | Cc1nnc(SCCNC(=O)C(C)c2n[nH]c(=O)c3ccccc23)s1 |
| InChI | InChI=1S/C16H17N5O2S2/c1-9(13-11-5-3-4-6-12(11)15(23)20-19-13)14(22)17-7-8-24-16-21-18-10(2)25-16/h3-6,9H,7-8H2,1-2H3,(H,17,22)(H,20,23) |
| InChIKey | BGLRSPOKAURBIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|