C20H23N5O2 — CID 99928932
(2R)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide (PubChem CID 99928932) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is (2R)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide.
| Compound Name | (2R)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide |
|---|---|
| PubChem CID | 99928932 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2R)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-2-(4-oxo-3H-phthalazin-1-yl)propanamide |
| SMILES | Cc1ccc(NCCCNC(=O)[C@H](C)c2n[nH]c(=O)c3ccccc23)nc1 |
| InChI | InChI=1S/C20H23N5O2/c1-13-8-9-17(23-12-13)21-10-5-11-22-19(26)14(2)18-15-6-3-4-7-16(15)20(27)25-24-18/h3-4,6-9,12,14H,5,10-11H2,1-2H3,(H,21,23)(H,22,26)(H,25,27)/t14-/m1/s1 |
| InChIKey | RLXFUNSDYNXITH-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|