C18H24N4O — CID 119888012
2-amino-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-3-phenylpropanamide (PubChem CID 119888012) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-amino-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119888012 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-amino-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-3-phenylpropanamide |
| SMILES | Cc1ccc(NCCCNC(=O)C(N)Cc2ccccc2)nc1 |
| InChI | InChI=1S/C18H24N4O/c1-14-8-9-17(22-13-14)20-10-5-11-21-18(23)16(19)12-15-6-3-2-4-7-15/h2-4,6-9,13,16H,5,10-12,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | KSAFWPCWGHUCTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|