C18H27N5O — CID 97071138
(2R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methyl-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]propanamide (PubChem CID 97071138) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (2R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methyl-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]propanamide.
| Compound Name | (2R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methyl-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 97071138 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methyl-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]propanamide |
| SMILES | Cc1ccc(NCCCNC(=O)[C@H](C)Cc2c(C)n[nH]c2C)nc1 |
| InChI | InChI=1S/C18H27N5O/c1-12-6-7-17(21-11-12)19-8-5-9-20-18(24)13(2)10-16-14(3)22-23-15(16)4/h6-7,11,13H,5,8-10H2,1-4H3,(H,19,21)(H,20,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | LJCRQGYJVOZQDU-CYBMUJFWSA-N |
| XLogP | 2.53 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|