C17H24N4OS — CID 51959987
1-methyl-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 51959987) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-methyl-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-methyl-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 51959987 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-methyl-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | Cc1ccc(NCCCNC(=O)N(C)[C@H](C)c2cccs2)nc1 |
| InChI | InChI=1S/C17H24N4OS/c1-13-7-8-16(20-12-13)18-9-5-10-19-17(22)21(3)14(2)15-6-4-11-23-15/h4,6-8,11-12,14H,5,9-10H2,1-3H3,(H,18,20)(H,19,22)/t14-/m1/s1 |
| InChIKey | VTYVTSFDALEWDX-CQSZACIVSA-N |
| XLogP | 3.66 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|