C16H19FN2OS — CID 30886324
3-[(3-fluoro-4-methylphenyl)methyl]-1-methyl-1-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 30886324) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)methyl]-1-methyl-1-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)methyl]-1-methyl-1-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 30886324 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)methyl]-1-methyl-1-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | Cc1ccc(CNC(=O)N(C)[C@H](C)c2cccs2)cc1F |
| InChI | InChI=1S/C16H19FN2OS/c1-11-6-7-13(9-14(11)17)10-18-16(20)19(3)12(2)15-5-4-8-21-15/h4-9,12H,10H2,1-3H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | FDUXGKKIDSDVKF-GFCCVEGCSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |