C17H22N2O3S — CID 111459238
3-[[2-(2-hydroxyethoxy)phenyl]methyl]-1-methyl-1-(1-thiophen-2-ylethyl)urea (PubChem CID 111459238) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-[[2-(2-hydroxyethoxy)phenyl]methyl]-1-methyl-1-(1-thiophen-2-ylethyl)urea.
| Compound Name | 3-[[2-(2-hydroxyethoxy)phenyl]methyl]-1-methyl-1-(1-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 111459238 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-[[2-(2-hydroxyethoxy)phenyl]methyl]-1-methyl-1-(1-thiophen-2-ylethyl)urea |
| SMILES | CC(c1cccs1)N(C)C(=O)NCc1ccccc1OCCO |
| InChI | InChI=1S/C17H22N2O3S/c1-13(16-8-5-11-23-16)19(2)17(21)18-12-14-6-3-4-7-15(14)22-10-9-20/h3-8,11,13,20H,9-10,12H2,1-2H3,(H,18,21) |
| InChIKey | GMCQRNOGTIFSBR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |