C15H17N5O3S2 — CID 72875441
1-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea (PubChem CID 72875441) has the molecular formula C15H17N5O3S2 and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea.
| Compound Name | 1-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 72875441 |
| Molecular Formula | C15H17N5O3S2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-3-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
| SMILES | Cc1nnc(SCCNC(=O)Nc2ccccc2N2CCOC2=O)s1 |
| InChI | InChI=1S/C15H17N5O3S2/c1-10-18-19-14(25-10)24-9-6-16-13(21)17-11-4-2-3-5-12(11)20-7-8-23-15(20)22/h2-5H,6-9H2,1H3,(H2,16,17,21) |
| InChIKey | CRPOUNKVAJOZSJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|