C11H13Cl2N3O3S — CID 43619929
N-(2-amino-4,6-dichlorophenyl)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetamide (PubChem CID 43619929) has the molecular formula C11H13Cl2N3O3S and a molecular weight of 338.22 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetamide |
|---|---|
| PubChem CID | 43619929 |
| Molecular Formula | C11H13Cl2N3O3S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)CN1CCCS1(=O)=O |
| InChI | InChI=1S/C11H13Cl2N3O3S/c12-7-4-8(13)11(9(14)5-7)15-10(17)6-16-2-1-3-20(16,18)19/h4-5H,1-3,6,14H2,(H,15,17) |
| InChIKey | YOTRQLUYJKONGS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|