C9H6Cl2F3NO3 — CID 54262088
2-chloro-N-[3-chloro-2-hydroxy-5-(trifluoromethoxy)phenyl]acetamide (PubChem CID 54262088) has the molecular formula C9H6Cl2F3NO3 and a molecular weight of 304.05 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-2-hydroxy-5-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-chloro-2-hydroxy-5-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54262088 |
| Molecular Formula | C9H6Cl2F3NO3 |
| Molecular Weight | 304.05 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-chloro-N-[3-chloro-2-hydroxy-5-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1cc(OC(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C9H6Cl2F3NO3/c10-3-7(16)15-6-2-4(18-9(12,13)14)1-5(11)8(6)17/h1-2,17H,3H2,(H,15,16) |
| InChIKey | REFNTRUIWDNWGH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|