C10H6F4N2O2 — CID 168520551
2-cyano-N-[2-fluoro-5-(trifluoromethoxy)phenyl]acetamide (PubChem CID 168520551) has the molecular formula C10H6F4N2O2 and a molecular weight of 262.16 g/mol. Its IUPAC name is 2-cyano-N-[2-fluoro-5-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-fluoro-5-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 168520551 |
| Molecular Formula | C10H6F4N2O2 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-cyano-N-[2-fluoro-5-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H6F4N2O2/c11-7-2-1-6(18-10(12,13)14)5-8(7)16-9(17)3-4-15/h1-2,5H,3H2,(H,16,17) |
| InChIKey | LLDSZXKUNZIKCB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |