C11H6F3N3O2 — CID 168520569
2-cyano-N-[4-cyano-2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 168520569) has the molecular formula C11H6F3N3O2 and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-cyano-N-[4-cyano-2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-cyano-2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 168520569 |
| Molecular Formula | C11H6F3N3O2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-cyano-N-[4-cyano-2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(C#N)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H6F3N3O2/c12-11(13,14)19-9-5-7(6-16)1-2-8(9)17-10(18)3-4-15/h1-2,5H,3H2,(H,17,18) |
| InChIKey | AIAWKOLHHPYBFL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |