C20H18F4N2O3 — CID 11993033
3-tert-butyl-N-[4-cyano-2-(trifluoromethoxy)phenyl]-5-fluoro-2-hydroxy-6-methylbenzamide (PubChem CID 11993033) has the molecular formula C20H18F4N2O3 and a molecular weight of 410.37 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-cyano-2-(trifluoromethoxy)phenyl]-5-fluoro-2-hydroxy-6-methylbenzamide.
| Compound Name | 3-tert-butyl-N-[4-cyano-2-(trifluoromethoxy)phenyl]-5-fluoro-2-hydroxy-6-methylbenzamide |
|---|---|
| PubChem CID | 11993033 |
| Molecular Formula | C20H18F4N2O3 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-tert-butyl-N-[4-cyano-2-(trifluoromethoxy)phenyl]-5-fluoro-2-hydroxy-6-methylbenzamide |
| SMILES | Cc1c(F)cc(C(C)(C)C)c(O)c1C(=O)Nc1ccc(C#N)cc1OC(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O3/c1-10-13(21)8-12(19(2,3)4)17(27)16(10)18(28)26-14-6-5-11(9-25)7-15(14)29-20(22,23)24/h5-8,27H,1-4H3,(H,26,28) |
| InChIKey | LYBDRURKLWTFJN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |