C16H16N2O3 — CID 104848980
N-(4-cyano-2-methoxyphenyl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 104848980) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-(4-cyano-2-methoxyphenyl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(4-cyano-2-methoxyphenyl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 104848980 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(4-cyano-2-methoxyphenyl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | COc1cc(C#N)ccc1NC(=O)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C16H16N2O3/c1-9-10(2)21-11(3)15(9)16(19)18-13-6-5-12(8-17)7-14(13)20-4/h5-7H,1-4H3,(H,18,19) |
| InChIKey | JLWYOKGQZMIVDM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |