C10H5BrF4N2O3 — CID 168523660
N-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-2-cyanoacetamide (PubChem CID 168523660) has the molecular formula C10H5BrF4N2O3 and a molecular weight of 357.06 g/mol. Its IUPAC name is N-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-2-cyanoacetamide.
| Compound Name | N-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 168523660 |
| Molecular Formula | C10H5BrF4N2O3 |
| Molecular Weight | 357.06 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | N-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1cc(Br)c(F)c(OC(F)(F)F)c1O |
| InChI | InChI=1S/C10H5BrF4N2O3/c11-4-3-5(17-6(18)1-2-16)8(19)9(7(4)12)20-10(13,14)15/h3,19H,1H2,(H,17,18) |
| InChIKey | KNNZVWYUXAFPOW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.06 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|