C11H10Cl2F3N3O — CID 139405307
2-chloro-N-[5-chloro-2-[cyclopropyl(trifluoromethyl)amino]-4-pyridinyl]acetamide (PubChem CID 139405307) has the molecular formula C11H10Cl2F3N3O and a molecular weight of 328.12 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-2-[cyclopropyl(trifluoromethyl)amino]-4-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[5-chloro-2-[cyclopropyl(trifluoromethyl)amino]-4-pyridinyl]acetamide |
|---|---|
| PubChem CID | 139405307 |
| Molecular Formula | C11H10Cl2F3N3O |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-chloro-N-[5-chloro-2-[cyclopropyl(trifluoromethyl)amino]-4-pyridinyl]acetamide |
| SMILES | O=C(CCl)Nc1cc(N(C2CC2)C(F)(F)F)ncc1Cl |
| InChI | InChI=1S/C11H10Cl2F3N3O/c12-4-10(20)18-8-3-9(17-5-7(8)13)19(6-1-2-6)11(14,15)16/h3,5-6H,1-2,4H2,(H,17,18,20) |
| InChIKey | JHTGRMUSIISKGR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|