C11H13Cl2N3O2 — CID 139405306
2-chloro-N-(5-chloro-2-morpholin-4-yl-4-pyridinyl)acetamide (PubChem CID 139405306) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 2-chloro-N-(5-chloro-2-morpholin-4-yl-4-pyridinyl)acetamide.
| Compound Name | 2-chloro-N-(5-chloro-2-morpholin-4-yl-4-pyridinyl)acetamide |
|---|---|
| PubChem CID | 139405306 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-chloro-N-(5-chloro-2-morpholin-4-yl-4-pyridinyl)acetamide |
| SMILES | O=C(CCl)Nc1cc(N2CCOCC2)ncc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O2/c12-6-11(17)15-9-5-10(14-7-8(9)13)16-1-3-18-4-2-16/h5,7H,1-4,6H2,(H,14,15,17) |
| InChIKey | ZFHLZWKAQCVIDP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|