C13H8ClF4N3O — CID 130473225
2-chloro-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]acetamide (PubChem CID 130473225) has the molecular formula C13H8ClF4N3O and a molecular weight of 333.67 g/mol. Its IUPAC name is 2-chloro-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 130473225 |
| Molecular Formula | C13H8ClF4N3O |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-chloro-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(-c2cncc(F)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C13H8ClF4N3O/c14-4-11(22)20-10-2-1-9(21-12(10)13(16,17)18)7-3-8(15)6-19-5-7/h1-3,5-6H,4H2,(H,20,22) |
| InChIKey | DPGSLFWWPJKMFY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|