C18H17F4N3O2 — CID 130471307
cyclohexyl N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 130471307) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is cyclohexyl N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | cyclohexyl N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 130471307 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | cyclohexyl N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2cncc(F)c2)nc1C(F)(F)F)OC1CCCCC1 |
| InChI | InChI=1S/C18H17F4N3O2/c19-12-8-11(9-23-10-12)14-6-7-15(16(24-14)18(20,21)22)25-17(26)27-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,25,26) |
| InChIKey | HPELQMNMZCESSM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |