C15H11F4N3O — CID 130472969
(E)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]but-2-enamide (PubChem CID 130472969) has the molecular formula C15H11F4N3O and a molecular weight of 325.27 g/mol. Its IUPAC name is (E)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]but-2-enamide.
| Compound Name | (E)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 130472969 |
| Molecular Formula | C15H11F4N3O |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (E)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(-c2cncc(F)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C15H11F4N3O/c1-2-3-13(23)21-12-5-4-11(22-14(12)15(17,18)19)9-6-10(16)8-20-7-9/h2-8H,1H3,(H,21,23)/b3-2+ |
| InChIKey | YZMRRVMHNANRGN-NSCUHMNNSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|