C11H12ClF3N4O — CID 62238262
5-chloro-N-cyclopropyl-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 62238262) has the molecular formula C11H12ClF3N4O and a molecular weight of 308.69 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-cyclopropyl-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62238262 |
| Molecular Formula | C11H12ClF3N4O |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 5-chloro-N-cyclopropyl-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | NNc1ncc(C(=O)N(CC(F)(F)F)C2CC2)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N4O/c12-8-3-6(4-17-9(8)18-16)10(20)19(7-1-2-7)5-11(13,14)15/h3-4,7H,1-2,5,16H2,(H,17,18) |
| InChIKey | AGSWUYDPGOAPFN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|