C12H15F3N4O — CID 81255905
N-cyclopropyl-4-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 81255905) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is N-cyclopropyl-4-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81255905 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-cyclopropyl-4-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(NN)c(C(=O)N(CC(F)(F)F)C2CC2)cn1 |
| InChI | InChI=1S/C12H15F3N4O/c1-7-4-10(18-16)9(5-17-7)11(20)19(8-2-3-8)6-12(13,14)15/h4-5,8H,2-3,6,16H2,1H3,(H,17,18) |
| InChIKey | VCWQXPBWXZUROS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|