C13H6Br4Cl2N2O — CID 3259704
1,3-bis(2,6-dibromo-4-chlorophenyl)urea (PubChem CID 3259704) has the molecular formula C13H6Br4Cl2N2O and a molecular weight of 596.73 g/mol. Its IUPAC name is 1,3-bis(2,6-dibromo-4-chlorophenyl)urea.
| Compound Name | 1,3-bis(2,6-dibromo-4-chlorophenyl)urea |
|---|---|
| PubChem CID | 3259704 |
| Molecular Formula | C13H6Br4Cl2N2O |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 591.66 |
| IUPAC Name | 1,3-bis(2,6-dibromo-4-chlorophenyl)urea |
| SMILES | O=C(Nc1c(Br)cc(Cl)cc1Br)Nc1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C13H6Br4Cl2N2O/c14-7-1-5(18)2-8(15)11(7)20-13(22)21-12-9(16)3-6(19)4-10(12)17/h1-4H,(H2,20,21,22) |
| InChIKey | VPBWONANWJLUCE-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |