C9H5Br2Cl2NO — CID 131059733
2-chloro-N-(2,6-dibromo-4-chlorophenyl)prop-2-enamide (PubChem CID 131059733) has the molecular formula C9H5Br2Cl2NO and a molecular weight of 373.86 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dibromo-4-chlorophenyl)prop-2-enamide.
| Compound Name | 2-chloro-N-(2,6-dibromo-4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 131059733 |
| Molecular Formula | C9H5Br2Cl2NO |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 370.81 |
| IUPAC Name | 2-chloro-N-(2,6-dibromo-4-chlorophenyl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)Nc1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C9H5Br2Cl2NO/c1-4(12)9(15)14-8-6(10)2-5(13)3-7(8)11/h2-3H,1H2,(H,14,15) |
| InChIKey | HGXRQMXMYAROPC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|