C10H12BrClN2O — CID 155666927
3-bromo-5-chloro-N,N-dimethyl-2-(methylamino)benzamide (PubChem CID 155666927) has the molecular formula C10H12BrClN2O and a molecular weight of 291.58 g/mol. Its IUPAC name is 3-bromo-5-chloro-N,N-dimethyl-2-(methylamino)benzamide.
| Compound Name | 3-bromo-5-chloro-N,N-dimethyl-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 155666927 |
| Molecular Formula | C10H12BrClN2O |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 3-bromo-5-chloro-N,N-dimethyl-2-(methylamino)benzamide |
| SMILES | CNc1c(Br)cc(Cl)cc1C(=O)N(C)C |
| InChI | InChI=1S/C10H12BrClN2O/c1-13-9-7(10(15)14(2)3)4-6(12)5-8(9)11/h4-5,13H,1-3H3 |
| InChIKey | DKDWOOKJWGITLN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |