C15H17BrN2O — CID 81260425
4-[(6-bromonaphthalen-2-yl)amino]-N-methylbutanamide (PubChem CID 81260425) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 4-[(6-bromonaphthalen-2-yl)amino]-N-methylbutanamide.
| Compound Name | 4-[(6-bromonaphthalen-2-yl)amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 81260425 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-[(6-bromonaphthalen-2-yl)amino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCNc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C15H17BrN2O/c1-17-15(19)3-2-8-18-14-7-5-11-9-13(16)6-4-12(11)10-14/h4-7,9-10,18H,2-3,8H2,1H3,(H,17,19) |
| InChIKey | WBTMFLJVXHRHOE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|