C10H13Br2NO2 — CID 107599049
2-[2-(2,6-dibromoanilino)ethoxy]ethanol (PubChem CID 107599049) has the molecular formula C10H13Br2NO2 and a molecular weight of 339.03 g/mol. Its IUPAC name is 2-[2-(2,6-dibromoanilino)ethoxy]ethanol.
| Compound Name | 2-[2-(2,6-dibromoanilino)ethoxy]ethanol |
|---|---|
| PubChem CID | 107599049 |
| Molecular Formula | C10H13Br2NO2 |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 2-[2-(2,6-dibromoanilino)ethoxy]ethanol |
| SMILES | OCCOCCNc1c(Br)cccc1Br |
| InChI | InChI=1S/C10H13Br2NO2/c11-8-2-1-3-9(12)10(8)13-4-6-15-7-5-14/h1-3,13-14H,4-7H2 |
| InChIKey | PLEYTEAGXLTLMQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|