C15H24FN3S — CID 63675070
2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]-5-fluorobenzenecarbothioamide (PubChem CID 63675070) has the molecular formula C15H24FN3S and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63675070 |
| Molecular Formula | C15H24FN3S |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]-5-fluorobenzenecarbothioamide |
| SMILES | CC(C)CC(CN(C)C)Nc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C15H24FN3S/c1-10(2)7-12(9-19(3)4)18-14-6-5-11(16)8-13(14)15(17)20/h5-6,8,10,12,18H,7,9H2,1-4H3,(H2,17,20) |
| InChIKey | FLXUPXJBHJKXAZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|