C15H13Cl2FN2S — CID 63674541
2-[1-(2,4-dichlorophenyl)ethylamino]-5-fluorobenzenecarbothioamide (PubChem CID 63674541) has the molecular formula C15H13Cl2FN2S and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethylamino]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63674541 |
| Molecular Formula | C15H13Cl2FN2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-5-fluorobenzenecarbothioamide |
| SMILES | CC(Nc1ccc(F)cc1C(N)=S)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2FN2S/c1-8(11-4-2-9(16)6-13(11)17)20-14-5-3-10(18)7-12(14)15(19)21/h2-8,20H,1H3,(H2,19,21) |
| InChIKey | QEMJUDZMYQUCGI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|