C15H13BrCl2N2S — CID 82786388
3-bromo-4-[1-(2,4-dichlorophenyl)ethylamino]benzenecarbothioamide (PubChem CID 82786388) has the molecular formula C15H13BrCl2N2S and a molecular weight of 404.16 g/mol. Its IUPAC name is 3-bromo-4-[1-(2,4-dichlorophenyl)ethylamino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[1-(2,4-dichlorophenyl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82786388 |
| Molecular Formula | C15H13BrCl2N2S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 3-bromo-4-[1-(2,4-dichlorophenyl)ethylamino]benzenecarbothioamide |
| SMILES | CC(Nc1ccc(C(N)=S)cc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2N2S/c1-8(11-4-3-10(17)7-13(11)18)20-14-5-2-9(15(19)21)6-12(14)16/h2-8,20H,1H3,(H2,19,21) |
| InChIKey | BUTXPQWSCLJIHE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|