C9H12ClN — CID 155292063
2-chloro-4-methyl-N,N-bis(trideuteriomethyl)aniline (PubChem CID 155292063) has the molecular formula C9H12ClN and a molecular weight of 175.69 g/mol. Its IUPAC name is 2-chloro-4-methyl-N,N-bis(trideuteriomethyl)aniline.
| Compound Name | 2-chloro-4-methyl-N,N-bis(trideuteriomethyl)aniline |
|---|---|
| PubChem CID | 155292063 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 175.69 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-chloro-4-methyl-N,N-bis(trideuteriomethyl)aniline |
| SMILES | [2H]C([2H])([2H])N(c1ccc(C)cc1Cl)C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H12ClN/c1-7-4-5-9(11(2)3)8(10)6-7/h4-6H,1-3H3/i2D3,3D3 |
| InChIKey | GPYYUDWDKLIISZ-XERRXZQWSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |