About 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea
1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea (PubChem CID 154159072) has the molecular formula C11H15ClN2O
and a molecular weight of 226.71 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea |
| PubChem CID | 154159072 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea |
| SMILES | Cc1ccc(N(C)C(=O)N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O/c1-8-5-6-10(9(12)7-8)14(4)11(15)13(2)3/h5-7H,1-4H3 |
| InChIKey | BEGLHBFFZXQSFF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea?
The IUPAC name of 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea (CID 154159072) is 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea.
What is the SMILES notation for 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea?
The canonical SMILES for 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea is Cc1ccc(N(C)C(=O)N(C)C)c(Cl)c1.
What is the InChIKey of 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea?
The InChIKey is BEGLHBFFZXQSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O/c1-8-5-6-10(9(12)7-8)14(4)11(15)13(2)3/h5-7H,1-4H3.
What are the key properties of 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea?
1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea has a molecular weight of 226.71 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea is sourced from PubChem (CID 154159072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).