C11H15ClN2O — CID 154159072
1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea (PubChem CID 154159072) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 154159072 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-1,3,3-trimethylurea |
| SMILES | Cc1ccc(N(C)C(=O)N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O/c1-8-5-6-10(9(12)7-8)14(4)11(15)13(2)3/h5-7H,1-4H3 |
| InChIKey | BEGLHBFFZXQSFF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |