C5H11ClN2O3 — CID 87710370
methyl (2R)-2,3-diamino-2-methyl-3-oxopropanoate;hydrochloride (PubChem CID 87710370) has the molecular formula C5H11ClN2O3 and a molecular weight of 182.61 g/mol. Its IUPAC name is methyl (2R)-2,3-diamino-2-methyl-3-oxopropanoate;hydrochloride.
| Compound Name | methyl (2R)-2,3-diamino-2-methyl-3-oxopropanoate;hydrochloride |
|---|---|
| PubChem CID | 87710370 |
| Molecular Formula | C5H11ClN2O3 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | methyl (2R)-2,3-diamino-2-methyl-3-oxopropanoate;hydrochloride |
| SMILES | COC(=O)[C@](C)(N)C(N)=O.Cl |
| InChI | InChI=1S/C5H10N2O3.ClH/c1-5(7,3(6)8)4(9)10-2;/h7H2,1-2H3,(H2,6,8);1H/t5-;/m1./s1 |
| InChIKey | UNISCIMNUYFOTB-NUBCRITNSA-N |
| XLogP | -1.22 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|