C22H23NO — CID 10686982
(1S)-2-(dimethylamino)-1,2,2-triphenylethanol (PubChem CID 10686982) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (1S)-2-(dimethylamino)-1,2,2-triphenylethanol.
| Compound Name | (1S)-2-(dimethylamino)-1,2,2-triphenylethanol |
|---|---|
| PubChem CID | 10686982 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (1S)-2-(dimethylamino)-1,2,2-triphenylethanol |
| SMILES | CN(C)C(c1ccccc1)(c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO/c1-23(2)22(19-14-8-4-9-15-19,20-16-10-5-11-17-20)21(24)18-12-6-3-7-13-18/h3-17,21,24H,1-2H3/t21-/m0/s1 |
| InChIKey | CMVPUEQUYRKWTE-NRFANRHFSA-N |
| XLogP | 4.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |