C13H18O2S — CID 155153377
(1S)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethane-1,2-diol (PubChem CID 155153377) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (1S)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethane-1,2-diol.
| Compound Name | (1S)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 155153377 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1S)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethane-1,2-diol |
| SMILES | CS(C)(C)C#Cc1ccc([C@H](O)CO)cc1 |
| InChI | InChI=1S/C13H18O2S/c1-16(2,3)9-8-11-4-6-12(7-5-11)13(15)10-14/h4-7,13-15H,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | VHFSOONXUCYNLA-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|