About (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol
(1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol (PubChem CID 170054438) has the molecular formula C13H18OS
and a molecular weight of 222.35 g/mol. Its IUPAC name is (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol |
| PubChem CID | 170054438 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(C#CS(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18OS/c1-11(14)13-7-5-12(6-8-13)9-10-15(2,3)4/h5-8,11,14H,1-4H3/t11-/m1/s1 |
| InChIKey | YQFJGPDBBLHZGB-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol?
The IUPAC name of (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol (CID 170054438) is (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol.
What is the SMILES notation for (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol?
The canonical SMILES for (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol is C[C@@H](O)c1ccc(C#CS(C)(C)C)cc1.
What is the InChIKey of (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol?
The InChIKey is YQFJGPDBBLHZGB-LLVKDONJSA-N. The full InChI is InChI=1S/C13H18OS/c1-11(14)13-7-5-12(6-8-13)9-10-15(2,3)4/h5-8,11,14H,1-4H3/t11-/m1/s1.
What are the key properties of (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol?
(1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol has a molecular weight of 222.35 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[4-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]ethanol is sourced from PubChem (CID 170054438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).