C8H13N2O3+ — CID 166159140
[6-(1,2-dihydroxyethyl)-3-pyridinyl]-methoxyazanium (PubChem CID 166159140) has the molecular formula C8H13N2O3+ and a molecular weight of 185.20 g/mol. Its IUPAC name is [6-(1,2-dihydroxyethyl)-3-pyridinyl]-methoxyazanium.
| Compound Name | [6-(1,2-dihydroxyethyl)-3-pyridinyl]-methoxyazanium |
|---|---|
| PubChem CID | 166159140 |
| Molecular Formula | C8H13N2O3+ |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | [6-(1,2-dihydroxyethyl)-3-pyridinyl]-methoxyazanium |
| SMILES | CO[NH2+]c1ccc(C(O)CO)nc1 |
| InChI | InChI=1S/C8H12N2O3/c1-13-10-6-2-3-7(9-4-6)8(12)5-11/h2-4,8,10-12H,5H2,1H3/p+1 |
| InChIKey | XDMODNUTWPBRPN-UHFFFAOYSA-O |
| XLogP | -1.14 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|