About [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid
[6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid (PubChem CID 139580255) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid.
Molecular Properties
| Compound Name | [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid |
| PubChem CID | 139580255 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(O)CO)nc1 |
| InChI | InChI=1S/C8H10N2O4/c11-4-7(12)6-2-1-5(3-9-6)10-8(13)14/h1-3,7,10-12H,4H2,(H,13,14) |
| InChIKey | HSAXQICKBAMEBU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid?
The IUPAC name of [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid (CID 139580255) is [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid.
What is the SMILES notation for [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid?
The canonical SMILES for [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid is O=C(O)Nc1ccc(C(O)CO)nc1.
What is the InChIKey of [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid?
The InChIKey is HSAXQICKBAMEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c11-4-7(12)6-2-1-5(3-9-6)10-8(13)14/h1-3,7,10-12H,4H2,(H,13,14).
What are the key properties of [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid?
[6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid has a molecular weight of 198.18 g/mol, XLogP of 0.20, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,2-dihydroxyethyl)-3-pyridinyl]carbamic acid is sourced from PubChem (CID 139580255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).