C22H23F5N2O4 — CID 166583841
(2S,3R,4R,5S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166583841) has the molecular formula C22H23F5N2O4 and a molecular weight of 474.43 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166583841 |
| Molecular Formula | C22H23F5N2O4 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1c([C@@H]2[C@@H](C(=O)Nc3ccc([C@@H](O)CO)nc3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H23F5N2O4/c1-10-13(5-6-14(23)18(10)24)17-11(2)21(3,22(25,26)27)33-19(17)20(32)29-12-4-7-15(28-8-12)16(31)9-30/h4-8,11,16-17,19,30-31H,9H2,1-3H3,(H,29,32)/t11-,16+,17-,19+,21+/m1/s1 |
| InChIKey | WXOXTDNHPXDBOR-KMMXOXLZSA-N |
| XLogP | 3.77 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |