C21H22F5N3O3 — CID 167212379
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylamino)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167212379) has the molecular formula C21H22F5N3O3 and a molecular weight of 459.42 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylamino)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylamino)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167212379 |
| Molecular Formula | C21H22F5N3O3 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylamino)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | CNc1ccc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)cn1 |
| InChI | InChI=1S/C21H22F5N3O3/c1-10-15(12-6-7-13(22)16(23)17(12)31-4)18(32-20(10,2)21(24,25)26)19(30)29-11-5-8-14(27-3)28-9-11/h5-10,15,18H,1-4H3,(H,27,28)(H,29,30)/t10-,15-,18+,20+/m0/s1 |
| InChIKey | AUJFIBOPSUXMIH-WJVRSIEWSA-N |
| XLogP | 4.49 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |