C23H22F5N3O5 — CID 170972721
4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]benzene-1,2-dicarboxamide (PubChem CID 170972721) has the molecular formula C23H22F5N3O5 and a molecular weight of 515.44 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]benzene-1,2-dicarboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 170972721 |
| Molecular Formula | C23H22F5N3O5 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]benzene-1,2-dicarboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc(C(N)=O)c(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H22F5N3O5/c1-9-15(12-6-7-14(24)16(25)17(12)35-3)18(36-22(9,2)23(26,27)28)21(34)31-10-4-5-11(19(29)32)13(8-10)20(30)33/h4-9,15,18H,1-3H3,(H2,29,32)(H2,30,33)(H,31,34)/t9-,15-,18+,22+/m0/s1 |
| InChIKey | FCCGKBXMAUYIPG-YSDFLYMLSA-N |
| XLogP | 3.25 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |