C22H22F5N3O4 — CID 169046652
4-[[(2R,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-methylpyridine-2-carboxamide (PubChem CID 169046652) has the molecular formula C22H22F5N3O4 and a molecular weight of 487.43 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-methylpyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169046652 |
| Molecular Formula | C22H22F5N3O4 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[[(2R,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-methylpyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@@H](C)[C@@](C)(C(F)(F)F)O[C@H]2C(=O)Nc2cc(C)nc(C(N)=O)c2)ccc(F)c1F |
| InChI | InChI=1S/C22H22F5N3O4/c1-9-7-11(8-14(29-9)19(28)31)30-20(32)18-15(10(2)21(3,34-18)22(25,26)27)12-5-6-13(23)16(24)17(12)33-4/h5-8,10,15,18H,1-4H3,(H2,28,31)(H,29,30,32)/t10-,15-,18-,21+/m1/s1 |
| InChIKey | ZJYBVDTWEGOOBO-WUMOLIIISA-N |
| XLogP | 3.85 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |